C16H29N3O2 — CID 105239363
1-(2,5-dimethoxyphenyl)-N,N-diethyl-1-hydrazinyl-2-methylpropan-2-amine (PubChem CID 105239363) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-N,N-diethyl-1-hydrazinyl-2-methylpropan-2-amine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-N,N-diethyl-1-hydrazinyl-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 105239363 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-N,N-diethyl-1-hydrazinyl-2-methylpropan-2-amine |
| SMILES | CCN(CC)C(C)(C)C(NN)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C16H29N3O2/c1-7-19(8-2)16(3,4)15(18-17)13-11-12(20-5)9-10-14(13)21-6/h9-11,15,18H,7-8,17H2,1-6H3 |
| InChIKey | KWIVSCXUXZHQMA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|