C20H23NO8 — CID 10525319
[(3R,4R,5R,9R)-3,4-diacetyloxy-7-benzyl-6-oxo-1-oxa-7-azaspiro[4.4]nonan-9-yl] acetate (PubChem CID 10525319) has the molecular formula C20H23NO8 and a molecular weight of 405.40 g/mol. Its IUPAC name is [(3R,4R,5R,9R)-3,4-diacetyloxy-7-benzyl-6-oxo-1-oxa-7-azaspiro[4.4]nonan-9-yl] acetate.
| Compound Name | [(3R,4R,5R,9R)-3,4-diacetyloxy-7-benzyl-6-oxo-1-oxa-7-azaspiro[4.4]nonan-9-yl] acetate |
|---|---|
| PubChem CID | 10525319 |
| Molecular Formula | C20H23NO8 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | [(3R,4R,5R,9R)-3,4-diacetyloxy-7-benzyl-6-oxo-1-oxa-7-azaspiro[4.4]nonan-9-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)CO[C@@]12C(=O)N(Cc1ccccc1)C[C@H]2OC(C)=O |
| InChI | InChI=1S/C20H23NO8/c1-12(22)27-16-11-26-20(18(16)29-14(3)24)17(28-13(2)23)10-21(19(20)25)9-15-7-5-4-6-8-15/h4-8,16-18H,9-11H2,1-3H3/t16-,17-,18-,20-/m1/s1 |
| InChIKey | FDHRKBSCIFAGLH-SOAMZJECSA-N |
| XLogP | 0.59 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|