C24H29N3O4 — CID 10526294
[4-[[5-(cyclohexylmethylcarbamoylamino)-2-methylphenyl]carbamoyl]phenyl] acetate (PubChem CID 10526294) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is [4-[[5-(cyclohexylmethylcarbamoylamino)-2-methylphenyl]carbamoyl]phenyl] acetate.
| Compound Name | [4-[[5-(cyclohexylmethylcarbamoylamino)-2-methylphenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 10526294 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | [4-[[5-(cyclohexylmethylcarbamoylamino)-2-methylphenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)Nc2cc(NC(=O)NCC3CCCCC3)ccc2C)cc1 |
| InChI | InChI=1S/C24H29N3O4/c1-16-8-11-20(26-24(30)25-15-18-6-4-3-5-7-18)14-22(16)27-23(29)19-9-12-21(13-10-19)31-17(2)28/h8-14,18H,3-7,15H2,1-2H3,(H,27,29)(H2,25,26,30) |
| InChIKey | WRSOOWJYWFMGQW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|