C13H17BrClN5O — CID 105263440
4-bromo-2-[[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-hydrazinylmethyl]aniline (PubChem CID 105263440) has the molecular formula C13H17BrClN5O and a molecular weight of 374.67 g/mol. Its IUPAC name is 4-bromo-2-[[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-hydrazinylmethyl]aniline.
| Compound Name | 4-bromo-2-[[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-hydrazinylmethyl]aniline |
|---|---|
| PubChem CID | 105263440 |
| Molecular Formula | C13H17BrClN5O |
| Molecular Weight | 374.67 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 4-bromo-2-[[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-hydrazinylmethyl]aniline |
| SMILES | COCCn1ncc(Cl)c1C(NN)c1cc(Br)ccc1N |
| InChI | InChI=1S/C13H17BrClN5O/c1-21-5-4-20-13(10(15)7-18-20)12(19-17)9-6-8(14)2-3-11(9)16/h2-3,6-7,12,19H,4-5,16-17H2,1H3 |
| InChIKey | ODRRZDBJEQTHFW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.67 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|