C11H13Br2ClN4OS — CID 105342423
[[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(4,5-dibromothiophen-2-yl)methyl]hydrazine (PubChem CID 105342423) has the molecular formula C11H13Br2ClN4OS and a molecular weight of 444.58 g/mol. Its IUPAC name is [[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(4,5-dibromothiophen-2-yl)methyl]hydrazine.
| Compound Name | [[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(4,5-dibromothiophen-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105342423 |
| Molecular Formula | C11H13Br2ClN4OS |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 441.89 |
| IUPAC Name | [[4-chloro-1-(2-methoxyethyl)pyrazol-5-yl]-(4,5-dibromothiophen-2-yl)methyl]hydrazine |
| SMILES | COCCn1ncc(Cl)c1C(NN)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H13Br2ClN4OS/c1-19-3-2-18-10(7(14)5-16-18)9(17-15)8-4-6(12)11(13)20-8/h4-5,9,17H,2-3,15H2,1H3 |
| InChIKey | QLLLLTBBYHYEOX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|