C9H10Cl2F2N2 — CID 105265201
[3-(2,4-dichlorophenyl)-1,1-difluoropropan-2-yl]hydrazine (PubChem CID 105265201) has the molecular formula C9H10Cl2F2N2 and a molecular weight of 255.09 g/mol. Its IUPAC name is [3-(2,4-dichlorophenyl)-1,1-difluoropropan-2-yl]hydrazine.
| Compound Name | [3-(2,4-dichlorophenyl)-1,1-difluoropropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105265201 |
| Molecular Formula | C9H10Cl2F2N2 |
| Molecular Weight | 255.09 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | [3-(2,4-dichlorophenyl)-1,1-difluoropropan-2-yl]hydrazine |
| SMILES | NNC(Cc1ccc(Cl)cc1Cl)C(F)F |
| InChI | InChI=1S/C9H10Cl2F2N2/c10-6-2-1-5(7(11)4-6)3-8(15-14)9(12)13/h1-2,4,8-9,15H,3,14H2 |
| InChIKey | XHKHRBDJXAJASA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.09 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|