C6H8Cl2F2N4 — CID 105265541
[2-chloro-1-(4-chloro-1-methylpyrazol-5-yl)-2,2-difluoroethyl]hydrazine (PubChem CID 105265541) has the molecular formula C6H8Cl2F2N4 and a molecular weight of 245.06 g/mol. Its IUPAC name is [2-chloro-1-(4-chloro-1-methylpyrazol-5-yl)-2,2-difluoroethyl]hydrazine.
| Compound Name | [2-chloro-1-(4-chloro-1-methylpyrazol-5-yl)-2,2-difluoroethyl]hydrazine |
|---|---|
| PubChem CID | 105265541 |
| Molecular Formula | C6H8Cl2F2N4 |
| Molecular Weight | 245.06 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | [2-chloro-1-(4-chloro-1-methylpyrazol-5-yl)-2,2-difluoroethyl]hydrazine |
| SMILES | Cn1ncc(Cl)c1C(NN)C(F)(F)Cl |
| InChI | InChI=1S/C6H8Cl2F2N4/c1-14-4(3(7)2-12-14)5(13-11)6(8,9)10/h2,5,13H,11H2,1H3 |
| InChIKey | XBUMEGHJHSUMPL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.06 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|