C8H13ClN4 — CID 105269743
1-(4-chloro-1-methylpyrazol-5-yl)but-3-enylhydrazine (PubChem CID 105269743) has the molecular formula C8H13ClN4 and a molecular weight of 200.67 g/mol. Its IUPAC name is 1-(4-chloro-1-methylpyrazol-5-yl)but-3-enylhydrazine.
| Compound Name | 1-(4-chloro-1-methylpyrazol-5-yl)but-3-enylhydrazine |
|---|---|
| PubChem CID | 105269743 |
| Molecular Formula | C8H13ClN4 |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 1-(4-chloro-1-methylpyrazol-5-yl)but-3-enylhydrazine |
| SMILES | C=CCC(NN)c1c(Cl)cnn1C |
| InChI | InChI=1S/C8H13ClN4/c1-3-4-7(12-10)8-6(9)5-11-13(8)2/h3,5,7,12H,1,4,10H2,2H3 |
| InChIKey | MBNBJAYNYOQSSC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|