About [2-chloro-2,2-difluoro-1-(2-methyltriazol-4-yl)ethyl]hydrazine
[2-chloro-2,2-difluoro-1-(2-methyltriazol-4-yl)ethyl]hydrazine (PubChem CID 130603794) has the molecular formula C5H8ClF2N5
and a molecular weight of 211.60 g/mol. Its IUPAC name is [2-chloro-2,2-difluoro-1-(2-methyltriazol-4-yl)ethyl]hydrazine.
Molecular Properties
| Compound Name | [2-chloro-2,2-difluoro-1-(2-methyltriazol-4-yl)ethyl]hydrazine |
| PubChem CID | 130603794 |
| Molecular Formula | C5H8ClF2N5 |
| Molecular Weight | 211.60 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | [2-chloro-2,2-difluoro-1-(2-methyltriazol-4-yl)ethyl]hydrazine |
| SMILES | Cn1ncc(C(NN)C(F)(F)Cl)n1 |
| InChI | InChI=1S/C5H8ClF2N5/c1-13-10-2-3(12-13)4(11-9)5(6,7)8/h2,4,11H,9H2,1H3 |
| InChIKey | VCIQSJNOWQQYNV-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.60 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-chloro-2,2-difluoro-1-(2-methyltriazol-4-yl)ethyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-chloro-2,2-difluoro-1-(2-methyltriazol-4-yl)ethyl]hydrazine?
The IUPAC name of [2-chloro-2,2-difluoro-1-(2-methyltriazol-4-yl)ethyl]hydrazine (CID 130603794) is [2-chloro-2,2-difluoro-1-(2-methyltriazol-4-yl)ethyl]hydrazine.
What is the SMILES notation for [2-chloro-2,2-difluoro-1-(2-methyltriazol-4-yl)ethyl]hydrazine?
The canonical SMILES for [2-chloro-2,2-difluoro-1-(2-methyltriazol-4-yl)ethyl]hydrazine is Cn1ncc(C(NN)C(F)(F)Cl)n1.
What is the InChIKey of [2-chloro-2,2-difluoro-1-(2-methyltriazol-4-yl)ethyl]hydrazine?
The InChIKey is VCIQSJNOWQQYNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8ClF2N5/c1-13-10-2-3(12-13)4(11-9)5(6,7)8/h2,4,11H,9H2,1H3.
What are the key properties of [2-chloro-2,2-difluoro-1-(2-methyltriazol-4-yl)ethyl]hydrazine?
[2-chloro-2,2-difluoro-1-(2-methyltriazol-4-yl)ethyl]hydrazine has a molecular weight of 211.60 g/mol, XLogP of 0.15, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-chloro-2,2-difluoro-1-(2-methyltriazol-4-yl)ethyl]hydrazine is sourced from PubChem (CID 130603794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).