C25H32ClNO3 — CID 10526608
1-[2-[3,3-bis(2-methylphenyl)prop-2-enoxy]ethyl]piperidin-1-ium-3-carboxylic acid chloride (PubChem CID 10526608) has the molecular formula C25H32ClNO3 and a molecular weight of 429.99 g/mol. Its IUPAC name is 1-[2-[3,3-bis(2-methylphenyl)prop-2-enoxy]ethyl]piperidin-1-ium-3-carboxylic acid chloride.
| Compound Name | 1-[2-[3,3-bis(2-methylphenyl)prop-2-enoxy]ethyl]piperidin-1-ium-3-carboxylic acid chloride |
|---|---|
| PubChem CID | 10526608 |
| Molecular Formula | C25H32ClNO3 |
| Molecular Weight | 429.99 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 1-[2-[3,3-bis(2-methylphenyl)prop-2-enoxy]ethyl]piperidin-1-ium-3-carboxylic acid chloride |
| SMILES | Cc1ccccc1C(=CCOCC[NH+]1CCCC(C(=O)O)C1)c1ccccc1C.[Cl-] |
| InChI | InChI=1S/C25H31NO3.ClH/c1-19-8-3-5-11-22(19)24(23-12-6-4-9-20(23)2)13-16-29-17-15-26-14-7-10-21(18-26)25(27)28;/h3-6,8-9,11-13,21H,7,10,14-18H2,1-2H3,(H,27,28);1H |
| InChIKey | BGXDCRMBQQWIQC-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 50.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.99 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|