C23H28ClNO3 — CID 10644767
1-[2-(3,3-diphenylprop-2-enoxy)ethyl]piperidin-1-ium-3-carboxylic acid chloride (PubChem CID 10644767) has the molecular formula C23H28ClNO3 and a molecular weight of 401.93 g/mol. Its IUPAC name is 1-[2-(3,3-diphenylprop-2-enoxy)ethyl]piperidin-1-ium-3-carboxylic acid chloride.
| Compound Name | 1-[2-(3,3-diphenylprop-2-enoxy)ethyl]piperidin-1-ium-3-carboxylic acid chloride |
|---|---|
| PubChem CID | 10644767 |
| Molecular Formula | C23H28ClNO3 |
| Molecular Weight | 401.93 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 1-[2-(3,3-diphenylprop-2-enoxy)ethyl]piperidin-1-ium-3-carboxylic acid chloride |
| SMILES | O=C(O)C1CCC[NH+](CCOCC=C(c2ccccc2)c2ccccc2)C1.[Cl-] |
| InChI | InChI=1S/C23H27NO3.ClH/c25-23(26)21-12-7-14-24(18-21)15-17-27-16-13-22(19-8-3-1-4-9-19)20-10-5-2-6-11-20;/h1-6,8-11,13,21H,7,12,14-18H2,(H,25,26);1H |
| InChIKey | WWXHHBMCYYVJSF-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 50.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.93 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|