C21H27ClN2O3S — CID 10622168
(3S)-1-[2-[(E)-[(2-methylphenyl)-(4-methylthiophen-2-yl)methylidene]amino]oxyethyl]piperidin-1-ium-3-carboxylic acid chloride (PubChem CID 10622168) has the molecular formula C21H27ClN2O3S and a molecular weight of 422.98 g/mol. Its IUPAC name is (3S)-1-[2-[(E)-[(2-methylphenyl)-(4-methylthiophen-2-yl)methylidene]amino]oxyethyl]piperidin-1-ium-3-carboxylic acid chloride.
| Compound Name | (3S)-1-[2-[(E)-[(2-methylphenyl)-(4-methylthiophen-2-yl)methylidene]amino]oxyethyl]piperidin-1-ium-3-carboxylic acid chloride |
|---|---|
| PubChem CID | 10622168 |
| Molecular Formula | C21H27ClN2O3S |
| Molecular Weight | 422.98 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | (3S)-1-[2-[(E)-[(2-methylphenyl)-(4-methylthiophen-2-yl)methylidene]amino]oxyethyl]piperidin-1-ium-3-carboxylic acid chloride |
| SMILES | Cc1csc(/C(=N/OCC[NH+]2CCC[C@H](C(=O)O)C2)c2ccccc2C)c1.[Cl-] |
| InChI | InChI=1S/C21H26N2O3S.ClH/c1-15-12-19(27-14-15)20(18-8-4-3-6-16(18)2)22-26-11-10-23-9-5-7-17(13-23)21(24)25;/h3-4,6,8,12,14,17H,5,7,9-11,13H2,1-2H3,(H,24,25);1H/b22-20+;/t17-;/m0./s1 |
| InChIKey | FRDUTDWPJLQIHA-CZLADSTGSA-N |
| XLogP | -0.48 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.98 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|