C21H23Cl3N2O3 — CID 10718678
(3R)-1-[2-[bis(3-chlorophenyl)methylideneamino]oxyethyl]piperidin-1-ium-3-carboxylic acid chloride (PubChem CID 10718678) has the molecular formula C21H23Cl3N2O3 and a molecular weight of 457.79 g/mol. Its IUPAC name is (3R)-1-[2-[bis(3-chlorophenyl)methylideneamino]oxyethyl]piperidin-1-ium-3-carboxylic acid chloride.
| Compound Name | (3R)-1-[2-[bis(3-chlorophenyl)methylideneamino]oxyethyl]piperidin-1-ium-3-carboxylic acid chloride |
|---|---|
| PubChem CID | 10718678 |
| Molecular Formula | C21H23Cl3N2O3 |
| Molecular Weight | 457.79 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | (3R)-1-[2-[bis(3-chlorophenyl)methylideneamino]oxyethyl]piperidin-1-ium-3-carboxylic acid chloride |
| SMILES | O=C(O)[C@@H]1CCC[NH+](CCON=C(c2cccc(Cl)c2)c2cccc(Cl)c2)C1.[Cl-] |
| InChI | InChI=1S/C21H22Cl2N2O3.ClH/c22-18-7-1-4-15(12-18)20(16-5-2-8-19(23)13-16)24-28-11-10-25-9-3-6-17(14-25)21(26)27;/h1-2,4-5,7-8,12-13,17H,3,6,9-11,14H2,(H,26,27);1H/t17-;/m1./s1 |
| InChIKey | HAKLRFPYUSFJHQ-UNTBIKODSA-N |
| XLogP | 0.15 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.79 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|