C12H24N2O — CID 105269879
[1-(cyclohexen-1-yl)-3-propoxypropan-2-yl]hydrazine (PubChem CID 105269879) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is [1-(cyclohexen-1-yl)-3-propoxypropan-2-yl]hydrazine.
| Compound Name | [1-(cyclohexen-1-yl)-3-propoxypropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105269879 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | [1-(cyclohexen-1-yl)-3-propoxypropan-2-yl]hydrazine |
| SMILES | CCCOCC(CC1=CCCCC1)NN |
| InChI | InChI=1S/C12H24N2O/c1-2-8-15-10-12(14-13)9-11-6-4-3-5-7-11/h6,12,14H,2-5,7-10,13H2,1H3 |
| InChIKey | KTQATWUEFIOOMP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|