C30H50O2 — CID 10527202
(6E,10E,14E)-17-(3,3-dimethyloxiran-2-yl)-6,11,15-trimethyl-2-(4-methylpent-3-enyl)heptadeca-6,10,14-trienal (PubChem CID 10527202) has the molecular formula C30H50O2 and a molecular weight of 442.73 g/mol. Its IUPAC name is (6E,10E,14E)-17-(3,3-dimethyloxiran-2-yl)-6,11,15-trimethyl-2-(4-methylpent-3-enyl)heptadeca-6,10,14-trienal.
| Compound Name | (6E,10E,14E)-17-(3,3-dimethyloxiran-2-yl)-6,11,15-trimethyl-2-(4-methylpent-3-enyl)heptadeca-6,10,14-trienal |
|---|---|
| PubChem CID | 10527202 |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.38 |
| IUPAC Name | (6E,10E,14E)-17-(3,3-dimethyloxiran-2-yl)-6,11,15-trimethyl-2-(4-methylpent-3-enyl)heptadeca-6,10,14-trienal |
| SMILES | CC(C)=CCCC(C=O)CCC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C30H50O2/c1-24(2)13-10-19-28(23-31)20-12-18-26(4)15-9-8-14-25(3)16-11-17-27(5)21-22-29-30(6,7)32-29/h13-15,17,23,28-29H,8-12,16,18-22H2,1-7H3/b25-14+,26-15+,27-17+ |
| InChIKey | KQUFWTSJFPFHRJ-YWVAEKJXSA-N |
| XLogP | 9.08 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|