C30H46O — CID 10025289
3-[(3E,11E,15E)-16-ethynyl-3,7,12,19-tetramethylicosa-3,7,11,15,18-pentaenyl]-2,2-dimethyloxirane (PubChem CID 10025289) has the molecular formula C30H46O and a molecular weight of 422.70 g/mol. Its IUPAC name is 3-[(3E,11E,15E)-16-ethynyl-3,7,12,19-tetramethylicosa-3,7,11,15,18-pentaenyl]-2,2-dimethyloxirane.
| Compound Name | 3-[(3E,11E,15E)-16-ethynyl-3,7,12,19-tetramethylicosa-3,7,11,15,18-pentaenyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 10025289 |
| Molecular Formula | C30H46O |
| Molecular Weight | 422.70 g/mol |
| Exact Mass | 422.35 |
| IUPAC Name | 3-[(3E,11E,15E)-16-ethynyl-3,7,12,19-tetramethylicosa-3,7,11,15,18-pentaenyl]-2,2-dimethyloxirane |
| SMILES | C#C/C(=C/CC/C(C)=C/CCC=C(C)CC/C=C(\C)CCC1OC1(C)C)CC=C(C)C |
| InChI | InChI=1S/C30H46O/c1-9-28(22-20-24(2)3)19-13-18-26(5)15-11-10-14-25(4)16-12-17-27(6)21-23-29-30(7,8)31-29/h1,14-15,17,19-20,29H,10-13,16,18,21-23H2,2-8H3/b25-14?,26-15+,27-17+,28-19- |
| InChIKey | KJXOWUIFIZGXFN-RKQKIZJSSA-N |
| XLogP | 9.04 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.70 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|