C29H50OS — CID 11797731
2,2-dimethyl-3-[(3E,7E,11E)-3,7,12-trimethyl-14-(6-methyl-5-tritiohept-5-en-2-yl)sulfanyltetradeca-3,7,11-trienyl]oxirane (PubChem CID 11797731) has the molecular formula C29H50OS and a molecular weight of 448.79 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(3E,7E,11E)-3,7,12-trimethyl-14-(6-methyl-5-tritiohept-5-en-2-yl)sulfanyltetradeca-3,7,11-trienyl]oxirane.
| Compound Name | 2,2-dimethyl-3-[(3E,7E,11E)-3,7,12-trimethyl-14-(6-methyl-5-tritiohept-5-en-2-yl)sulfanyltetradeca-3,7,11-trienyl]oxirane |
|---|---|
| PubChem CID | 11797731 |
| Molecular Formula | C29H50OS |
| Molecular Weight | 448.79 g/mol |
| Exact Mass | 448.37 |
| IUPAC Name | 2,2-dimethyl-3-[(3E,7E,11E)-3,7,12-trimethyl-14-(6-methyl-5-tritiohept-5-en-2-yl)sulfanyltetradeca-3,7,11-trienyl]oxirane |
| SMILES | [3H]C(CCC(C)SCC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC1OC1(C)C)=C(C)C |
| InChI | InChI=1S/C29H50OS/c1-23(2)13-11-18-27(6)31-22-21-26(5)15-10-9-14-24(3)16-12-17-25(4)19-20-28-29(7,8)30-28/h13-15,17,27-28H,9-12,16,18-22H2,1-8H3/b24-14+,25-17+,26-15+/i13T |
| InChIKey | CRZHANPLXOIADK-TYLWFXRWSA-N |
| XLogP | 9.60 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.79 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|