C17H29N3O — CID 105273848
[2-ethoxy-3,3-dimethyl-1-(5,6,7,8-tetrahydroquinolin-8-yl)butyl]hydrazine (PubChem CID 105273848) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is [2-ethoxy-3,3-dimethyl-1-(5,6,7,8-tetrahydroquinolin-8-yl)butyl]hydrazine.
| Compound Name | [2-ethoxy-3,3-dimethyl-1-(5,6,7,8-tetrahydroquinolin-8-yl)butyl]hydrazine |
|---|---|
| PubChem CID | 105273848 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | [2-ethoxy-3,3-dimethyl-1-(5,6,7,8-tetrahydroquinolin-8-yl)butyl]hydrazine |
| SMILES | CCOC(C(NN)C1CCCc2cccnc21)C(C)(C)C |
| InChI | InChI=1S/C17H29N3O/c1-5-21-16(17(2,3)4)15(20-18)13-10-6-8-12-9-7-11-19-14(12)13/h7,9,11,13,15-16,20H,5-6,8,10,18H2,1-4H3 |
| InChIKey | NSLCALDSLDXMGO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|