C21H27IN2O — CID 10527533
(8bS)-4-benzyl-7-methoxy-3,3,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-3-ium iodide (PubChem CID 10527533) has the molecular formula C21H27IN2O and a molecular weight of 450.36 g/mol. Its IUPAC name is (8bS)-4-benzyl-7-methoxy-3,3,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-3-ium iodide.
| Compound Name | (8bS)-4-benzyl-7-methoxy-3,3,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-3-ium iodide |
|---|---|
| PubChem CID | 10527533 |
| Molecular Formula | C21H27IN2O |
| Molecular Weight | 450.36 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | (8bS)-4-benzyl-7-methoxy-3,3,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-3-ium iodide |
| SMILES | COc1ccc2c(c1)[C@]1(C)CC[N+](C)(C)C1N2Cc1ccccc1.[I-] |
| InChI | InChI=1S/C21H27N2O.HI/c1-21-12-13-23(2,3)20(21)22(15-16-8-6-5-7-9-16)19-11-10-17(24-4)14-18(19)21;/h5-11,14,20H,12-13,15H2,1-4H3;1H/q+1;/p-1/t20?,21-;/m0./s1 |
| InChIKey | ADMBVTPEMABYFP-NPTNJNKCSA-M |
| XLogP | 0.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|