C27H29N3O4 — CID 46234128
[(8bS)-4-benzyl-8b-methyl-1,2,3,3a-tetrahydropyrrolo[2,3-b]indol-7-yl] N-(3,4-dimethoxyphenyl)carbamate (PubChem CID 46234128) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is [(8bS)-4-benzyl-8b-methyl-1,2,3,3a-tetrahydropyrrolo[2,3-b]indol-7-yl] N-(3,4-dimethoxyphenyl)carbamate.
| Compound Name | [(8bS)-4-benzyl-8b-methyl-1,2,3,3a-tetrahydropyrrolo[2,3-b]indol-7-yl] N-(3,4-dimethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 46234128 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | [(8bS)-4-benzyl-8b-methyl-1,2,3,3a-tetrahydropyrrolo[2,3-b]indol-7-yl] N-(3,4-dimethoxyphenyl)carbamate |
| SMILES | COc1ccc(NC(=O)Oc2ccc3c(c2)[C@]2(C)CCNC2N3Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C27H29N3O4/c1-27-13-14-28-25(27)30(17-18-7-5-4-6-8-18)22-11-10-20(16-21(22)27)34-26(31)29-19-9-12-23(32-2)24(15-19)33-3/h4-12,15-16,25,28H,13-14,17H2,1-3H3,(H,29,31)/t25?,27-/m0/s1 |
| InChIKey | NTKHOAMMAWHHJP-GPNIZQGCSA-N |
| XLogP | 4.91 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |