C26H25N3O2S2 — CID 10528558
(2S,3R,4S,5S)-N,1-dibenzyl-4-nitro-2,5-dithiophen-2-ylpyrrolidin-3-amine (PubChem CID 10528558) has the molecular formula C26H25N3O2S2 and a molecular weight of 475.64 g/mol. Its IUPAC name is (2S,3R,4S,5S)-N,1-dibenzyl-4-nitro-2,5-dithiophen-2-ylpyrrolidin-3-amine.
| Compound Name | (2S,3R,4S,5S)-N,1-dibenzyl-4-nitro-2,5-dithiophen-2-ylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 10528558 |
| Molecular Formula | C26H25N3O2S2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | (2S,3R,4S,5S)-N,1-dibenzyl-4-nitro-2,5-dithiophen-2-ylpyrrolidin-3-amine |
| SMILES | O=[N+]([O-])[C@H]1[C@H](NCc2ccccc2)[C@@H](c2cccs2)N(Cc2ccccc2)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C26H25N3O2S2/c30-29(31)26-23(27-17-19-9-3-1-4-10-19)24(21-13-7-15-32-21)28(18-20-11-5-2-6-12-20)25(26)22-14-8-16-33-22/h1-16,23-27H,17-18H2/t23-,24-,25-,26+/m1/s1 |
| InChIKey | FABYPKNWLULAJW-POTDNYQPSA-N |
| XLogP | 5.91 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|