C14H17N3O2S2 — CID 10663707
(2S,3R,4S,5S)-N,1-dimethyl-4-nitro-2,5-dithiophen-2-ylpyrrolidin-3-amine (PubChem CID 10663707) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (2S,3R,4S,5S)-N,1-dimethyl-4-nitro-2,5-dithiophen-2-ylpyrrolidin-3-amine.
| Compound Name | (2S,3R,4S,5S)-N,1-dimethyl-4-nitro-2,5-dithiophen-2-ylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 10663707 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (2S,3R,4S,5S)-N,1-dimethyl-4-nitro-2,5-dithiophen-2-ylpyrrolidin-3-amine |
| SMILES | CN[C@H]1[C@H]([N+](=O)[O-])[C@@H](c2cccs2)N(C)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C14H17N3O2S2/c1-15-11-12(9-5-3-7-20-9)16(2)13(14(11)17(18)19)10-6-4-8-21-10/h3-8,11-15H,1-2H3/t11-,12-,13-,14+/m1/s1 |
| InChIKey | PIPAPHJAWYZCIG-SYQHCUMBSA-N |
| XLogP | 2.77 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|