C20H29N3O2S2 — CID 10716368
(2S,3R,4S,5S)-N,1-dibutyl-4-nitro-2,5-dithiophen-2-ylpyrrolidin-3-amine (PubChem CID 10716368) has the molecular formula C20H29N3O2S2 and a molecular weight of 407.61 g/mol. Its IUPAC name is (2S,3R,4S,5S)-N,1-dibutyl-4-nitro-2,5-dithiophen-2-ylpyrrolidin-3-amine.
| Compound Name | (2S,3R,4S,5S)-N,1-dibutyl-4-nitro-2,5-dithiophen-2-ylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 10716368 |
| Molecular Formula | C20H29N3O2S2 |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | (2S,3R,4S,5S)-N,1-dibutyl-4-nitro-2,5-dithiophen-2-ylpyrrolidin-3-amine |
| SMILES | CCCCN[C@H]1[C@H]([N+](=O)[O-])[C@@H](c2cccs2)N(CCCC)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C20H29N3O2S2/c1-3-5-11-21-17-18(15-9-7-13-26-15)22(12-6-4-2)19(20(17)23(24)25)16-10-8-14-27-16/h7-10,13-14,17-21H,3-6,11-12H2,1-2H3/t17-,18-,19-,20+/m1/s1 |
| InChIKey | RTWFKNFQTKQYSK-WTGUMLROSA-N |
| XLogP | 5.11 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|