C13H30N2 — CID 105294313
2,2,3,8-tetramethylnonan-5-ylhydrazine (PubChem CID 105294313) has the molecular formula C13H30N2 and a molecular weight of 214.40 g/mol. Its IUPAC name is 2,2,3,8-tetramethylnonan-5-ylhydrazine.
| Compound Name | 2,2,3,8-tetramethylnonan-5-ylhydrazine |
|---|---|
| PubChem CID | 105294313 |
| Molecular Formula | C13H30N2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.24 |
| IUPAC Name | 2,2,3,8-tetramethylnonan-5-ylhydrazine |
| SMILES | CC(C)CCC(CC(C)C(C)(C)C)NN |
| InChI | InChI=1S/C13H30N2/c1-10(2)7-8-12(15-14)9-11(3)13(4,5)6/h10-12,15H,7-9,14H2,1-6H3 |
| InChIKey | CLTYYWZXBRHNCI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|