C30H26N2O4S — CID 10529712
N,N-dibenzyl-4-[3-(4-methylphenyl)-2-oxo-1,3-oxazol-4-yl]benzenesulfonamide (PubChem CID 10529712) has the molecular formula C30H26N2O4S and a molecular weight of 510.62 g/mol. Its IUPAC name is N,N-dibenzyl-4-[3-(4-methylphenyl)-2-oxo-1,3-oxazol-4-yl]benzenesulfonamide.
| Compound Name | N,N-dibenzyl-4-[3-(4-methylphenyl)-2-oxo-1,3-oxazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10529712 |
| Molecular Formula | C30H26N2O4S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | N,N-dibenzyl-4-[3-(4-methylphenyl)-2-oxo-1,3-oxazol-4-yl]benzenesulfonamide |
| SMILES | Cc1ccc(-n2c(-c3ccc(S(=O)(=O)N(Cc4ccccc4)Cc4ccccc4)cc3)coc2=O)cc1 |
| InChI | InChI=1S/C30H26N2O4S/c1-23-12-16-27(17-13-23)32-29(22-36-30(32)33)26-14-18-28(19-15-26)37(34,35)31(20-24-8-4-2-5-9-24)21-25-10-6-3-7-11-25/h2-19,22H,20-21H2,1H3 |
| InChIKey | PCKALYUCJFQSLA-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 72.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |