C36H36N2O — CID 10529765
(1R,4S)-N,N,4-tribenzyl-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1H-naphthalen-1-amine (PubChem CID 10529765) has the molecular formula C36H36N2O and a molecular weight of 512.70 g/mol. Its IUPAC name is (1R,4S)-N,N,4-tribenzyl-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1H-naphthalen-1-amine.
| Compound Name | (1R,4S)-N,N,4-tribenzyl-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1H-naphthalen-1-amine |
|---|---|
| PubChem CID | 10529765 |
| Molecular Formula | C36H36N2O |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | (1R,4S)-N,N,4-tribenzyl-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1H-naphthalen-1-amine |
| SMILES | CC1(C)COC([C@@]2(Cc3ccccc3)C=C[C@@H](N(Cc3ccccc3)Cc3ccccc3)c3ccccc32)=N1 |
| InChI | InChI=1S/C36H36N2O/c1-35(2)27-39-34(37-35)36(24-28-14-6-3-7-15-28)23-22-33(31-20-12-13-21-32(31)36)38(25-29-16-8-4-9-17-29)26-30-18-10-5-11-19-30/h3-23,33H,24-27H2,1-2H3/t33-,36-/m1/s1 |
| InChIKey | JEVHFADZNBYJHR-YYFXGUOYSA-N |
| XLogP | 7.69 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|