C14H18N2O — CID 134858997
2-[(2S)-1-benzylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 134858997) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-[(2S)-1-benzylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[(2S)-1-benzylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 134858997 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 2-[(2S)-1-benzylaziridin-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC([C@@H]2CN2Cc2ccccc2)=N1 |
| InChI | InChI=1S/C14H18N2O/c1-14(2)10-17-13(15-14)12-9-16(12)8-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3/t12-,16?/m0/s1 |
| InChIKey | GDDMOGFSQZHWCM-HKALDPMFSA-N |
| XLogP | 2.08 |
| TPSA | 24.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|