C31H40N4O3 — CID 10529877
[1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl] nonanoate (PubChem CID 10529877) has the molecular formula C31H40N4O3 and a molecular weight of 516.69 g/mol. Its IUPAC name is [1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl] nonanoate.
| Compound Name | [1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl] nonanoate |
|---|---|
| PubChem CID | 10529877 |
| Molecular Formula | C31H40N4O3 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | [1-[2-(dimethylamino)ethylcarbamoyl]-5,6-dimethylpyrido[4,3-b]carbazol-9-yl] nonanoate |
| SMILES | CCCCCCCCC(=O)Oc1ccc2c(c1)c1cc3c(C(=O)NCCN(C)C)nccc3c(C)c1n2C |
| InChI | InChI=1S/C31H40N4O3/c1-6-7-8-9-10-11-12-28(36)38-22-13-14-27-24(19-22)26-20-25-23(21(2)30(26)35(27)5)15-16-32-29(25)31(37)33-17-18-34(3)4/h13-16,19-20H,6-12,17-18H2,1-5H3,(H,33,37) |
| InChIKey | DKTOPUGJRNETQW-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|