C11H13BrN2OS2 — CID 105299424
[2-(4-bromothiophen-2-yl)-1-(4-methoxythiophen-2-yl)ethyl]hydrazine (PubChem CID 105299424) has the molecular formula C11H13BrN2OS2 and a molecular weight of 333.28 g/mol. Its IUPAC name is [2-(4-bromothiophen-2-yl)-1-(4-methoxythiophen-2-yl)ethyl]hydrazine.
| Compound Name | [2-(4-bromothiophen-2-yl)-1-(4-methoxythiophen-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105299424 |
| Molecular Formula | C11H13BrN2OS2 |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | [2-(4-bromothiophen-2-yl)-1-(4-methoxythiophen-2-yl)ethyl]hydrazine |
| SMILES | COc1csc(C(Cc2cc(Br)cs2)NN)c1 |
| InChI | InChI=1S/C11H13BrN2OS2/c1-15-8-3-11(17-6-8)10(14-13)4-9-2-7(12)5-16-9/h2-3,5-6,10,14H,4,13H2,1H3 |
| InChIKey | GZCRZHFSNFPTCW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|