C30H62O4Si2 — CID 10530545
[(2R,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-3-tri(propan-2-yl)silyloxyoct-7-enyl] 2,2-dimethylpropanoate (PubChem CID 10530545) has the molecular formula C30H62O4Si2 and a molecular weight of 542.99 g/mol. Its IUPAC name is [(2R,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-3-tri(propan-2-yl)silyloxyoct-7-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-3-tri(propan-2-yl)silyloxyoct-7-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10530545 |
| Molecular Formula | C30H62O4Si2 |
| Molecular Weight | 542.99 g/mol |
| Exact Mass | 542.42 |
| IUPAC Name | [(2R,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-3-tri(propan-2-yl)silyloxyoct-7-enyl] 2,2-dimethylpropanoate |
| SMILES | C=CCC(O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C30H62O4Si2/c1-18-19-26(33-35(16,17)30(13,14)15)25(9)27(24(8)20-32-28(31)29(10,11)12)34-36(21(2)3,22(4)5)23(6)7/h18,21-27H,1,19-20H2,2-17H3/t24-,25-,26?,27+/m1/s1 |
| InChIKey | URBGCPCRGFEIDT-GWDBROLASA-N |
| XLogP | 9.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.99 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|