C38H78O5Si3 — CID 25108330
[(2S,4S,5S,6R,7S,8S,9Z)-4,6,8-trimethyl-2,5,7-tris(triethylsilyloxy)dodeca-9,11-dienyl] 2,2-dimethylpropanoate (PubChem CID 25108330) has the molecular formula C38H78O5Si3 and a molecular weight of 699.30 g/mol. Its IUPAC name is [(2S,4S,5S,6R,7S,8S,9Z)-4,6,8-trimethyl-2,5,7-tris(triethylsilyloxy)dodeca-9,11-dienyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,4S,5S,6R,7S,8S,9Z)-4,6,8-trimethyl-2,5,7-tris(triethylsilyloxy)dodeca-9,11-dienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 25108330 |
| Molecular Formula | C38H78O5Si3 |
| Molecular Weight | 699.30 g/mol |
| Exact Mass | 698.52 |
| IUPAC Name | [(2S,4S,5S,6R,7S,8S,9Z)-4,6,8-trimethyl-2,5,7-tris(triethylsilyloxy)dodeca-9,11-dienyl] 2,2-dimethylpropanoate |
| SMILES | C=C/C=C\[C@H](C)[C@H](O[Si](CC)(CC)CC)[C@H](C)[C@@H](O[Si](CC)(CC)CC)[C@@H](C)C[C@@H](COC(=O)C(C)(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C38H78O5Si3/c1-17-27-28-31(11)35(42-45(21-5,22-6)23-7)33(13)36(43-46(24-8,25-9)26-10)32(12)29-34(30-40-37(39)38(14,15)16)41-44(18-2,19-3)20-4/h17,27-28,31-36H,1,18-26,29-30H2,2-16H3/b28-27-/t31-,32-,33-,34-,35-,36-/m0/s1 |
| InChIKey | IEONHYCAOHZOLP-GCCVFFOUSA-N |
| XLogP | 11.79 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.30 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|