C27H54O5Si — CID 10601001
[(E,3R,4S,5R,7R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethoxy-4,8-dimethyldodec-9-enyl] 2,2-dimethylpropanoate (PubChem CID 10601001) has the molecular formula C27H54O5Si and a molecular weight of 486.81 g/mol. Its IUPAC name is [(E,3R,4S,5R,7R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethoxy-4,8-dimethyldodec-9-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E,3R,4S,5R,7R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethoxy-4,8-dimethyldodec-9-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10601001 |
| Molecular Formula | C27H54O5Si |
| Molecular Weight | 486.81 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | [(E,3R,4S,5R,7R,8S)-5-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethoxy-4,8-dimethyldodec-9-enyl] 2,2-dimethylpropanoate |
| SMILES | CC/C=C/[C@H](C)[C@@H](C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](CCOC(=O)C(C)(C)C)OC)OC |
| InChI | InChI=1S/C27H54O5Si/c1-14-15-16-20(2)23(30-11)19-24(32-33(12,13)27(7,8)9)21(3)22(29-10)17-18-31-25(28)26(4,5)6/h15-16,20-24H,14,17-19H2,1-13H3/b16-15+/t20-,21-,22+,23+,24+/m0/s1 |
| InChIKey | CKQIKVUSYXPVJT-FTELBFGDSA-N |
| XLogP | 7.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.81 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|