C27H54O4Si2 — CID 139192798
(2R)-2-[(3S,4S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethylheptan-2-yl]-2,3-dihydropyran-6-one (PubChem CID 139192798) has the molecular formula C27H54O4Si2 and a molecular weight of 498.90 g/mol. Its IUPAC name is (2R)-2-[(3S,4S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethylheptan-2-yl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(3S,4S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethylheptan-2-yl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 139192798 |
| Molecular Formula | C27H54O4Si2 |
| Molecular Weight | 498.90 g/mol |
| Exact Mass | 498.36 |
| IUPAC Name | (2R)-2-[(3S,4S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethylheptan-2-yl]-2,3-dihydropyran-6-one |
| SMILES | CC(C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/C27H54O4Si2/c1-19(2)23(30-32(12,13)25(4,5)6)20(3)24(31-33(14,15)26(7,8)9)27(10,11)21-17-16-18-22(28)29-21/h16,18-21,23-24H,17H2,1-15H3/t20-,21+,23-,24-/m0/s1 |
| InChIKey | ZNWCFZFEHIFXFL-DVKRWUGUSA-N |
| XLogP | 7.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.90 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|