C29H57IO6Si — CID 155619148
[(E,3R,4R,5S,9S,10S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-1-iodo-4,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl] (2R)-2-methoxypropanoate (PubChem CID 155619148) has the molecular formula C29H57IO6Si and a molecular weight of 656.76 g/mol. Its IUPAC name is [(E,3R,4R,5S,9S,10S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-1-iodo-4,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl] (2R)-2-methoxypropanoate.
| Compound Name | [(E,3R,4R,5S,9S,10S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-1-iodo-4,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl] (2R)-2-methoxypropanoate |
|---|---|
| PubChem CID | 155619148 |
| Molecular Formula | C29H57IO6Si |
| Molecular Weight | 656.76 g/mol |
| Exact Mass | 656.30 |
| IUPAC Name | [(E,3R,4R,5S,9S,10S,12R)-12-[tert-butyl(dimethyl)silyl]oxy-1-iodo-4,10-dimethoxy-3,5,9-trimethyltetradec-1-en-6-yl] (2R)-2-methoxypropanoate |
| SMILES | CC[C@H](C[C@H](OC)[C@@H](C)CCC(OC(=O)[C@@H](C)OC)[C@H](C)[C@H](OC)[C@H](C)/C=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H57IO6Si/c1-14-24(36-37(12,13)29(6,7)8)19-26(33-10)20(2)15-16-25(35-28(31)23(5)32-9)22(4)27(34-11)21(3)17-18-30/h17-18,20-27H,14-16,19H2,1-13H3/b18-17+/t20-,21+,22-,23+,24+,25?,26-,27+/m0/s1 |
| InChIKey | WLLCVIHDRJKKNY-HVBXFEBCSA-N |
| XLogP | 7.79 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.76 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|