C27H51IO4Si2 — CID 44518866
[(1E,3R,8S)-1-iodo-3-methyl-6-methylidene-3,8-bis(triethylsilyloxy)undeca-1,10-dien-4-yl] acetate (PubChem CID 44518866) has the molecular formula C27H51IO4Si2 and a molecular weight of 622.78 g/mol. Its IUPAC name is [(1E,3R,8S)-1-iodo-3-methyl-6-methylidene-3,8-bis(triethylsilyloxy)undeca-1,10-dien-4-yl] acetate.
| Compound Name | [(1E,3R,8S)-1-iodo-3-methyl-6-methylidene-3,8-bis(triethylsilyloxy)undeca-1,10-dien-4-yl] acetate |
|---|---|
| PubChem CID | 44518866 |
| Molecular Formula | C27H51IO4Si2 |
| Molecular Weight | 622.78 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | [(1E,3R,8S)-1-iodo-3-methyl-6-methylidene-3,8-bis(triethylsilyloxy)undeca-1,10-dien-4-yl] acetate |
| SMILES | C=CC[C@@H](CC(=C)CC(OC(C)=O)[C@@](C)(/C=C/I)O[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C27H51IO4Si2/c1-11-18-25(31-33(12-2,13-3)14-4)21-23(8)22-26(30-24(9)29)27(10,19-20-28)32-34(15-5,16-6)17-7/h11,19-20,25-26H,1,8,12-18,21-22H2,2-7,9-10H3/b20-19+/t25-,26?,27+/m0/s1 |
| InChIKey | YCSBDNIYGPAECF-AZTOMZQJSA-N |
| XLogP | 8.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.78 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|