C31H36O11 — CID 10531369
[(2S,3S,4S)-5,7-dimethoxy-4-(2,4,6-trimethoxyphenyl)-2-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-chromen-3-yl] acetate (PubChem CID 10531369) has the molecular formula C31H36O11 and a molecular weight of 584.62 g/mol. Its IUPAC name is [(2S,3S,4S)-5,7-dimethoxy-4-(2,4,6-trimethoxyphenyl)-2-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-chromen-3-yl] acetate.
| Compound Name | [(2S,3S,4S)-5,7-dimethoxy-4-(2,4,6-trimethoxyphenyl)-2-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-chromen-3-yl] acetate |
|---|---|
| PubChem CID | 10531369 |
| Molecular Formula | C31H36O11 |
| Molecular Weight | 584.62 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | [(2S,3S,4S)-5,7-dimethoxy-4-(2,4,6-trimethoxyphenyl)-2-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-chromen-3-yl] acetate |
| SMILES | COc1cc(OC)c([C@H]2c3c(OC)cc(OC)cc3O[C@@H](c3cc(OC)c(OC)c(OC)c3)[C@H]2OC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C31H36O11/c1-16(32)41-31-28(26-20(35-4)12-18(33-2)13-21(26)36-5)27-22(37-6)14-19(34-3)15-23(27)42-29(31)17-10-24(38-7)30(40-9)25(11-17)39-8/h10-15,28-29,31H,1-9H3/t28-,29-,31-/m0/s1 |
| InChIKey | LIAUUBIOACSWIH-QMOZSOIISA-N |
| XLogP | 4.95 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.62 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |