C42H44O15 — CID 162938980
[4-[3-acetyloxy-7-methoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)-2,3-dihydrochromen-8-yl]-7-methoxy-2-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-chromen-3-yl] acetate (PubChem CID 162938980) has the molecular formula C42H44O15 and a molecular weight of 788.80 g/mol. Its IUPAC name is [4-[3-acetyloxy-7-methoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)-2,3-dihydrochromen-8-yl]-7-methoxy-2-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-chromen-3-yl] acetate.
| Compound Name | [4-[3-acetyloxy-7-methoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)-2,3-dihydrochromen-8-yl]-7-methoxy-2-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-chromen-3-yl] acetate |
|---|---|
| PubChem CID | 162938980 |
| Molecular Formula | C42H44O15 |
| Molecular Weight | 788.80 g/mol |
| Exact Mass | 788.27 |
| IUPAC Name | [4-[3-acetyloxy-7-methoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)-2,3-dihydrochromen-8-yl]-7-methoxy-2-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-chromen-3-yl] acetate |
| SMILES | COc1ccc2c(c1)OC(c1cc(OC)c(OC)c(OC)c1)C(OC(C)=O)C2c1c(OC)ccc2c1OC(c1cc(OC)c(OC)c(OC)c1)C(OC(C)=O)C2=O |
| InChI | InChI=1S/C42H44O15/c1-20(43)54-41-33(25-12-11-24(46-3)19-28(25)56-36(41)22-15-29(48-5)39(52-9)30(16-22)49-6)34-27(47-4)14-13-26-35(45)42(55-21(2)44)37(57-38(26)34)23-17-31(50-7)40(53-10)32(18-23)51-8/h11-19,33,36-37,41-42H,1-10H3 |
| InChIKey | UBMLVLLJYXEBJZ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 161.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.80 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |