C28H32N2O11S — CID 10531713
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4Z)-4-[(4-methoxyphenyl)methylidene]-5-oxo-1-prop-2-enylimidazol-2-yl]sulfanyloxan-2-yl]methyl acetate (PubChem CID 10531713) has the molecular formula C28H32N2O11S and a molecular weight of 604.63 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4Z)-4-[(4-methoxyphenyl)methylidene]-5-oxo-1-prop-2-enylimidazol-2-yl]sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4Z)-4-[(4-methoxyphenyl)methylidene]-5-oxo-1-prop-2-enylimidazol-2-yl]sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10531713 |
| Molecular Formula | C28H32N2O11S |
| Molecular Weight | 604.63 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4Z)-4-[(4-methoxyphenyl)methylidene]-5-oxo-1-prop-2-enylimidazol-2-yl]sulfanyloxan-2-yl]methyl acetate |
| SMILES | C=CCN1C(=O)/C(=C/c2ccc(OC)cc2)N=C1S[C@@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H32N2O11S/c1-7-12-30-26(35)21(13-19-8-10-20(36-6)11-9-19)29-28(30)42-27-25(40-18(5)34)24(39-17(4)33)23(38-16(3)32)22(41-27)14-37-15(2)31/h7-11,13,22-25,27H,1,12,14H2,2-6H3/b21-13-/t22-,23+,24+,25-,27+/m1/s1 |
| InChIKey | BZHBJVSCLUMKPU-ULVOYUEKSA-N |
| XLogP | 2.24 |
| TPSA | 156.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.63 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|