C32H34ClN3O10S — CID 10604634
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4Z)-1-(4-chlorophenyl)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxoimidazol-2-yl]sulfanyloxan-2-yl]methyl acetate (PubChem CID 10604634) has the molecular formula C32H34ClN3O10S and a molecular weight of 688.16 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4Z)-1-(4-chlorophenyl)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxoimidazol-2-yl]sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4Z)-1-(4-chlorophenyl)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxoimidazol-2-yl]sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10604634 |
| Molecular Formula | C32H34ClN3O10S |
| Molecular Weight | 688.16 g/mol |
| Exact Mass | 687.17 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4Z)-1-(4-chlorophenyl)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxoimidazol-2-yl]sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SC2=N/C(=C\c3ccc(N(C)C)cc3)C(=O)N2c2ccc(Cl)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C32H34ClN3O10S/c1-17(37)42-16-26-27(43-18(2)38)28(44-19(3)39)29(45-20(4)40)31(46-26)47-32-34-25(15-21-7-11-23(12-8-21)35(5)6)30(41)36(32)24-13-9-22(33)10-14-24/h7-15,26-29,31H,16H2,1-6H3/b25-15-/t26-,27-,28+,29-,31+/m1/s1 |
| InChIKey | AYCKRLMJHKGQRG-ONQLOPSHSA-N |
| XLogP | 3.97 |
| TPSA | 150.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.16 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|