C34H40AuNO9PS — CID 171691751
[4-(dimethylamino)phenyl]-diphenylphosphanium;gold;3,4,5-triacetyloxy-6-(acetyloxymethyl)oxane-2-thiolate (PubChem CID 171691751) has the molecular formula C34H40AuNO9PS and a molecular weight of 866.70 g/mol. Its IUPAC name is [4-(dimethylamino)phenyl]-diphenylphosphanium;gold;3,4,5-triacetyloxy-6-(acetyloxymethyl)oxane-2-thiolate.
| Compound Name | [4-(dimethylamino)phenyl]-diphenylphosphanium;gold;3,4,5-triacetyloxy-6-(acetyloxymethyl)oxane-2-thiolate |
|---|---|
| PubChem CID | 171691751 |
| Molecular Formula | C34H40AuNO9PS |
| Molecular Weight | 866.70 g/mol |
| Exact Mass | 866.18 |
| IUPAC Name | [4-(dimethylamino)phenyl]-diphenylphosphanium;gold;3,4,5-triacetyloxy-6-(acetyloxymethyl)oxane-2-thiolate |
| SMILES | CC(=O)OCC1OC([S-])C(OC(C)=O)C(OC(C)=O)C1OC(C)=O.CN(C)c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.[Au] |
| InChI | InChI=1S/C20H20NP.C14H20O9S.Au/c1-21(2)17-13-15-20(16-14-17)22(18-9-5-3-6-10-18)19-11-7-4-8-12-19;1-6(15)19-5-10-11(20-7(2)16)12(21-8(3)17)13(14(24)23-10)22-9(4)18;/h3-16H,1-2H3;10-14,24H,5H2,1-4H3; |
| InChIKey | CSQBVWMXGXTTOZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.70 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|