C43H50AuNO11PS — CID 171691760
gold;[(3E)-3-[(4-methoxyphenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]-diphenylphosphanium;3,4,5-triacetyloxy-6-(acetyloxymethyl)oxane-2-thiolate (PubChem CID 171691760) has the molecular formula C43H50AuNO11PS and a molecular weight of 1016.88 g/mol. Its IUPAC name is gold;[(3E)-3-[(4-methoxyphenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]-diphenylphosphanium;3,4,5-triacetyloxy-6-(acetyloxymethyl)oxane-2-thiolate.
| Compound Name | gold;[(3E)-3-[(4-methoxyphenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]-diphenylphosphanium;3,4,5-triacetyloxy-6-(acetyloxymethyl)oxane-2-thiolate |
|---|---|
| PubChem CID | 171691760 |
| Molecular Formula | C43H50AuNO11PS |
| Molecular Weight | 1016.88 g/mol |
| Exact Mass | 1016.25 |
| IUPAC Name | gold;[(3E)-3-[(4-methoxyphenyl)methylidene]-2-morpholin-4-ylcyclopenten-1-yl]-diphenylphosphanium;3,4,5-triacetyloxy-6-(acetyloxymethyl)oxane-2-thiolate |
| SMILES | CC(=O)OCC1OC([S-])C(OC(C)=O)C(OC(C)=O)C1OC(C)=O.COc1ccc(/C=C2\CCC([PH+](c3ccccc3)c3ccccc3)=C2N2CCOCC2)cc1.[Au] |
| InChI | InChI=1S/C29H30NO2P.C14H20O9S.Au/c1-31-25-15-12-23(13-16-25)22-24-14-17-28(29(24)30-18-20-32-21-19-30)33(26-8-4-2-5-9-26)27-10-6-3-7-11-27;1-6(15)19-5-10-11(20-7(2)16)12(21-8(3)17)13(14(24)23-10)22-9(4)18;/h2-13,15-16,22H,14,17-21H2,1H3;10-14,24H,5H2,1-4H3;/b24-22+;; |
| InChIKey | ZNOWMEBIPLDGFX-WPLNXYSRSA-N |
| XLogP | 4.90 |
| TPSA | 136.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1016.88 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|