C29H30N2O10S2 — CID 71966827
[(6S)-3,4,5-triacetyloxy-6-[1-(4-methylphenyl)-5-oxo-4-(thiophen-2-ylmethylidene)imidazol-2-yl]sulfanyloxan-2-yl]methyl acetate (PubChem CID 71966827) has the molecular formula C29H30N2O10S2 and a molecular weight of 630.70 g/mol. Its IUPAC name is [(6S)-3,4,5-triacetyloxy-6-[1-(4-methylphenyl)-5-oxo-4-(thiophen-2-ylmethylidene)imidazol-2-yl]sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(6S)-3,4,5-triacetyloxy-6-[1-(4-methylphenyl)-5-oxo-4-(thiophen-2-ylmethylidene)imidazol-2-yl]sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71966827 |
| Molecular Formula | C29H30N2O10S2 |
| Molecular Weight | 630.70 g/mol |
| Exact Mass | 630.13 |
| IUPAC Name | [(6S)-3,4,5-triacetyloxy-6-[1-(4-methylphenyl)-5-oxo-4-(thiophen-2-ylmethylidene)imidazol-2-yl]sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](SC2=NC(=Cc3cccs3)C(=O)N2c2ccc(C)cc2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C29H30N2O10S2/c1-15-8-10-20(11-9-15)31-27(36)22(13-21-7-6-12-42-21)30-29(31)43-28-26(40-19(5)35)25(39-18(4)34)24(38-17(3)33)23(41-28)14-37-16(2)32/h6-13,23-26,28H,14H2,1-5H3/t23?,24?,25?,26?,28-/m0/s1 |
| InChIKey | LSCPZPAGQREMNA-WAKJXLRYSA-N |
| XLogP | 3.62 |
| TPSA | 147.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.70 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|