C32H52N2O6SSi — CID 10531928
tert-butyl (4R)-4-[[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(1S,2R,3S)-2-methoxycarbonyl-3-phenylcyclopropyl]butan-2-yl]carbamoyl]-2,2-dimethyl-1,3-thiazolidine-3-carboxylate (PubChem CID 10531928) has the molecular formula C32H52N2O6SSi and a molecular weight of 620.93 g/mol. Its IUPAC name is tert-butyl (4R)-4-[[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(1S,2R,3S)-2-methoxycarbonyl-3-phenylcyclopropyl]butan-2-yl]carbamoyl]-2,2-dimethyl-1,3-thiazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(1S,2R,3S)-2-methoxycarbonyl-3-phenylcyclopropyl]butan-2-yl]carbamoyl]-2,2-dimethyl-1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10531928 |
| Molecular Formula | C32H52N2O6SSi |
| Molecular Weight | 620.93 g/mol |
| Exact Mass | 620.33 |
| IUPAC Name | tert-butyl (4R)-4-[[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(1S,2R,3S)-2-methoxycarbonyl-3-phenylcyclopropyl]butan-2-yl]carbamoyl]-2,2-dimethyl-1,3-thiazolidine-3-carboxylate |
| SMILES | CC[C@H](NC(=O)[C@@H]1CSC(C)(C)N1C(=O)OC(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1[C@H](C(=O)OC)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C32H52N2O6SSi/c1-13-21(33-27(35)22-19-41-32(8,9)34(22)29(37)39-30(2,3)4)26(40-42(11,12)31(5,6)7)24-23(25(24)28(36)38-10)20-17-15-14-16-18-20/h14-18,21-26H,13,19H2,1-12H3,(H,33,35)/t21-,22-,23-,24-,25+,26+/m0/s1 |
| InChIKey | OVBXVOXZBXYFPK-MGEKTERKSA-N |
| XLogP | 6.56 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.93 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|