C9H12Br2N2S — CID 105319938
[1-(4,5-dibromothiophen-2-yl)-3-methylbut-2-enyl]hydrazine (PubChem CID 105319938) has the molecular formula C9H12Br2N2S and a molecular weight of 340.08 g/mol. Its IUPAC name is [1-(4,5-dibromothiophen-2-yl)-3-methylbut-2-enyl]hydrazine.
| Compound Name | [1-(4,5-dibromothiophen-2-yl)-3-methylbut-2-enyl]hydrazine |
|---|---|
| PubChem CID | 105319938 |
| Molecular Formula | C9H12Br2N2S |
| Molecular Weight | 340.08 g/mol |
| Exact Mass | 337.91 |
| IUPAC Name | [1-(4,5-dibromothiophen-2-yl)-3-methylbut-2-enyl]hydrazine |
| SMILES | CC(C)=CC(NN)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C9H12Br2N2S/c1-5(2)3-7(13-12)8-4-6(10)9(11)14-8/h3-4,7,13H,12H2,1-2H3 |
| InChIKey | FJDMEPOGHNEZFY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.08 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|