C10H12Cl2N2 — CID 105320101
[1-(3,5-dichlorophenyl)-2-methylprop-2-enyl]hydrazine (PubChem CID 105320101) has the molecular formula C10H12Cl2N2 and a molecular weight of 231.13 g/mol. Its IUPAC name is [1-(3,5-dichlorophenyl)-2-methylprop-2-enyl]hydrazine.
| Compound Name | [1-(3,5-dichlorophenyl)-2-methylprop-2-enyl]hydrazine |
|---|---|
| PubChem CID | 105320101 |
| Molecular Formula | C10H12Cl2N2 |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | [1-(3,5-dichlorophenyl)-2-methylprop-2-enyl]hydrazine |
| SMILES | C=C(C)C(NN)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H12Cl2N2/c1-6(2)10(14-13)7-3-8(11)5-9(12)4-7/h3-5,10,14H,1,13H2,2H3 |
| InChIKey | HYLGSOZFXVAKJA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|