C14H28N4O — CID 105338046
[6-methoxy-4-methyl-1-(1,3,5-trimethylpyrazol-4-yl)hexan-3-yl]hydrazine (PubChem CID 105338046) has the molecular formula C14H28N4O and a molecular weight of 268.40 g/mol. Its IUPAC name is [6-methoxy-4-methyl-1-(1,3,5-trimethylpyrazol-4-yl)hexan-3-yl]hydrazine.
| Compound Name | [6-methoxy-4-methyl-1-(1,3,5-trimethylpyrazol-4-yl)hexan-3-yl]hydrazine |
|---|---|
| PubChem CID | 105338046 |
| Molecular Formula | C14H28N4O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | [6-methoxy-4-methyl-1-(1,3,5-trimethylpyrazol-4-yl)hexan-3-yl]hydrazine |
| SMILES | COCCC(C)C(CCc1c(C)nn(C)c1C)NN |
| InChI | InChI=1S/C14H28N4O/c1-10(8-9-19-5)14(16-15)7-6-13-11(2)17-18(4)12(13)3/h10,14,16H,6-9,15H2,1-5H3 |
| InChIKey | HJMVISVFZCEOPW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|