C17H24N2OS — CID 105341674
[1-benzothiophen-3-yl-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine (PubChem CID 105341674) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is [1-benzothiophen-3-yl-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine.
| Compound Name | [1-benzothiophen-3-yl-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105341674 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | [1-benzothiophen-3-yl-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine |
| SMILES | CC1(C)CC(C(NN)c2csc3ccccc23)C(C)(C)O1 |
| InChI | InChI=1S/C17H24N2OS/c1-16(2)9-13(17(3,4)20-16)15(19-18)12-10-21-14-8-6-5-7-11(12)14/h5-8,10,13,15,19H,9,18H2,1-4H3 |
| InChIKey | SXRBMOLUYSQPNU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|