C12H22N4O — CID 105252265
[1H-imidazol-2-yl-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine (PubChem CID 105252265) has the molecular formula C12H22N4O and a molecular weight of 238.34 g/mol. Its IUPAC name is [1H-imidazol-2-yl-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine.
| Compound Name | [1H-imidazol-2-yl-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105252265 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | [1H-imidazol-2-yl-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine |
| SMILES | CC1(C)CC(C(NN)c2ncc[nH]2)C(C)(C)O1 |
| InChI | InChI=1S/C12H22N4O/c1-11(2)7-8(12(3,4)17-11)9(16-13)10-14-5-6-15-10/h5-6,8-9,16H,7,13H2,1-4H3,(H,14,15) |
| InChIKey | WODXUBPPDUZOHD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|