C11H20N4OS — CID 105341631
[(2,2,5,5-tetramethyloxolan-3-yl)-(1,2,5-thiadiazol-3-yl)methyl]hydrazine (PubChem CID 105341631) has the molecular formula C11H20N4OS and a molecular weight of 256.38 g/mol. Its IUPAC name is [(2,2,5,5-tetramethyloxolan-3-yl)-(1,2,5-thiadiazol-3-yl)methyl]hydrazine.
| Compound Name | [(2,2,5,5-tetramethyloxolan-3-yl)-(1,2,5-thiadiazol-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105341631 |
| Molecular Formula | C11H20N4OS |
| Molecular Weight | 256.38 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | [(2,2,5,5-tetramethyloxolan-3-yl)-(1,2,5-thiadiazol-3-yl)methyl]hydrazine |
| SMILES | CC1(C)CC(C(NN)c2cnsn2)C(C)(C)O1 |
| InChI | InChI=1S/C11H20N4OS/c1-10(2)5-7(11(3,4)16-10)9(14-12)8-6-13-17-15-8/h6-7,9,14H,5,12H2,1-4H3 |
| InChIKey | SIHSVCPZFIIQLJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|