C15H23IN2O — CID 105341599
[(3-iodophenyl)-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine (PubChem CID 105341599) has the molecular formula C15H23IN2O and a molecular weight of 374.27 g/mol. Its IUPAC name is [(3-iodophenyl)-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine.
| Compound Name | [(3-iodophenyl)-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105341599 |
| Molecular Formula | C15H23IN2O |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | [(3-iodophenyl)-(2,2,5,5-tetramethyloxolan-3-yl)methyl]hydrazine |
| SMILES | CC1(C)CC(C(NN)c2cccc(I)c2)C(C)(C)O1 |
| InChI | InChI=1S/C15H23IN2O/c1-14(2)9-12(15(3,4)19-14)13(18-17)10-6-5-7-11(16)8-10/h5-8,12-13,18H,9,17H2,1-4H3 |
| InChIKey | HFTXLZMPLVDALP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|